Resigratinib
{{Short description|Chemical compound}}
{{infobox drug
| drug_name = Resigratinib
| image = Resigratinib.svg
| legal_UK =
| legal_DE =
| C = 26 | H = 27 | F = 2 | N = 7 | O = 3
| IUPAC_name =
| CAS_number = 2750709-91-0
| ChemSpiderID =
| PubChem = 162381323
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W728TB393W
| ChEMBL =
| StdInChI=1S/C26H27F2N7O3/c1-4-21(36)33-11-15(9-16(33)12-38-3)35-26(30-2)22(25(29)37)19(32-35)8-7-17-18(27)10-20-24(23(17)28)31-13-34(20)14-5-6-14/h4,10,13-16,30H,1,5-6,9,11-12H2,2-3H3,(H2,29,37)/t15-,16+/m0/s1
| StdInChIKey = YXVDEILMUVTDMK-JKSUJKDBSA-N
| SMILES = CNC1=C(C(=NN1[C@H]2C[C@@H](N(C2)C(=O)C=C)COC)C#CC3=C(C=C4C(=C3F)N=CN4C5CC5)F)C(=O)N
}}
Resigratinib (KIN-3248) is an experimental anticancer medication which acts as a fibroblast growth factor receptor inhibitor (FGFRi) and is in early stage human clinical trials.{{cite journal | vauthors = Franovic A, Mohan A, Uryu S, Wu Q, Jiang P, Miller N, Tyhonas J, Timple N, Severson P, Kania R, Murphy E | display-authors = 6 | title = Activity of KIN-3248, a next-generation pan-FGFR inhibitor, against acquired FGFR-gatekeeper and molecular-brake drug resistance mutations. | journal = Journal of Clinical Oncology | volume = 40 | issue = 4_suppl | date = February 2022 | pages = 461 | doi = 10.1200/JCO.2022.40.4_suppl.461 }}{{cite journal | vauthors = Harding JJ, Perez CA, Kato S, Sharma M, Garmezy B, Quah CS, Tam B, Severson P | display-authors = 6 | title = First in human (FIH) phase 1/1b study evaluating KIN-3248, a next-generation, irreversible pan-FGFR inhibitor (FGFRi), in patients (pts) with advanced cholangiocarcinoma (CCA) and other solid tumors harboring FGFR2 and/or FGFR3 gene alterations. | journal = Journal of Clinical Oncology | volume = 41 | issue = 4_suppl | date = February 2023 | page = TPS637-TPS637 | doi = 10.1200/JCO.2023.41.4_suppl.TPS637 | s2cid = 256257314 }}{{cite journal | vauthors = Wang Z, Anderson KS | title = Therapeutic Targeting of FGFR Signaling in Head and Neck Cancer | journal = Cancer Journal (Sudbury, Mass.) | volume = 28 | issue = 5 | pages = 354–362 | date = 2022 | pmid = 36165723 | pmc = 9523489 | doi = 10.1097/PPO.0000000000000615 }}