Estradiol butyrylacetate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 3-oxohexanoate

| image = Estradiol butyrylacetate.svg

| image_class = skin-invert-image

| width = 250px

| tradename = Follikosid, Follikoside, Klimanosid

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| class = Estrogen; Estrogen ester

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 60883-80-9

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 91667672

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 52084153

| UNII = 6ADI485E6C

| synonyms = EBA; Estradiol 17β-butyrylacetate

| C=24 | H=32 | N= | O=4

| SMILES = CCCC(=O)CC(=O)O[C@H]1CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@]12C

| StdInChI_Ref =

| StdInChI = 1S/C24H32O4/c1-3-4-16(25)14-23(27)28-22-10-9-21-20-7-5-15-13-17(26)6-8-18(15)19(20)11-12-24(21,22)2/h6,8,13,19-22,26H,3-5,7,9-12,14H2,1-2H3/t19-,20-,21+,22+,24+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = LLWMXKOTHFASEO-NTYLBUJVSA-N

}}

Estradiol butyrylacetate (EBA), sold under the brand names Follikosid and Klimanosid-R Depot (with testosterone ketolaurate and reserpine), is an estrogen medication which is no longer marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA129|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=898}}{{cite book| vauthors = Hager HH, Kern W, List PH, Roth HJ | chapter = Hormone |title=Hagers Handbuch der Pharmazeutischen Praxis: Für Apotheker, Arzneimittelhersteller, Ärzte und Medizinalbeamte: Wirkstoffgruppen II Chemikalien und Drogen (A-AL)| chapter-url = https://books.google.com/books?id=a2a0BgAAQBAJ&pg=PA157|date=29 July 2013|publisher=Springer-Verlag|isbn=978-3-662-25655-8|pages=157–}} It is an estrogen ester, specifically, an ester of estradiol. It is administered by intramuscular injection and a single 10 mg dose has been said to have a duration of action of 2 to 3 weeks.{{cite book|author=Heinrich Kahr|title=Konservative Therapie der Frauenkrankheiten: Anzeigen, Grenzen und Methoden Einschliesslich der Rezeptur|url=https://books.google.com/books?id=Hte1BgAAQBAJ&pg=PA20|date=8 March 2013|publisher=Springer-Verlag|isbn=978-3-7091-5694-0|pages=20–}}{{cite book | vauthors = Ufer J | title = Hormontherapie in der Frauenheilkunde: Grundlagen und Praxis | trans-title = Hormone Therapy in Gynecology: Principles and Practice | edition = 5th | language = de | date = 1 January 1978 | isbn = 978-3110066647 | oclc = 924728827 | publisher = de Gruyter | page = 276}} The excretion of EBA in women has been studied.{{cite journal | vauthors = Kaiser R | title = Die Östrogenausscheidung im Zyklus und nach Injektion von Östradiolestern. Ein Beitrag zur Therapie mit Depotöstrogenen | trans-title = Estrogen excretion during the cycle and after injection of estradiol esters. A contribution to therapy with depot estrogens | language = de | journal = Geburtshilfe Frauenheilkd | volume = 21 | pages = 868–78 | date = September 1961 | issn = 0016-5751 | pmid = 13750804 }}{{cite book | vauthors = Kaiser R | chapter = Über die Oestrogenausscheidung nach Injektion von Oestradiolestern | trans-chapter = Estrogen excretion after injection of estradiol esters | pages = 227–232 | doi = 10.1007/978-3-642-86860-3_24 | title = Gewebs-und Neurohormone: Physiologie des Melanophorenhormons | year = 1962 | trans-title = Tissue and Neurohormones: Physiology of the Melanophore Hormone | language = de | publisher = Springer, Berlin, Heidelberg | isbn = 978-3-540-02909-0}}