Estradiol mustard
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = [(8R,9S,13S,14S,17S)-3-[2-[4-[Bis(2-chloroethyl)amino]phenyl]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate
| image = Estradiol mustard.svg
| width = 250px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| class = Chemotherapeutic agent; Estrogen; Estrogen ester
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 22966-79-6
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 31586
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 29294
| UNII = GEO3F3A4K1
| KEGG =
| ChEBI = 82520
| ChEMBL = 1697793
| synonyms = NSC-112259; Estradiol 3,17β-bis(4-(bis(2-chloroethyl)amino)phenyl)acetate
| C=42 | H=50 | Cl=4 | N=2 | O=4
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)CC4=CC=C(C=C4)N(CCCl)CCCl)CCC5=C3C=CC(=C5)OC(=O)CC6=CC=C(C=C6)N(CCCl)CCCl
| StdInChI_Ref =
| StdInChI = 1S/C42H50Cl4N2O4/c1-42-17-16-36-35-13-11-34(51-40(49)26-29-2-7-32(8-3-29)47(22-18-43)23-19-44)28-31(35)6-12-37(36)38(42)14-15-39(42)52-41(50)27-30-4-9-33(10-5-30)48(24-20-45)25-21-46/h2-5,7-11,13,28,36-39H,6,12,14-27H2,1H3/t36-,37-,38+,39+,42+/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = LRSFXIJGHRPOQQ-VZRQQIPSSA-N
}}
Estradiol mustard, also known as estradiol 3,17β-bis(4-(bis(2-chloroethyl)amino)phenyl)acetate, is a semisynthetic, steroidal estrogen and cytostatic antineoplastic agent and a phenylacetic acid nitrogen mustard-coupled estrogen ester that was never marketed.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA898|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=898–}} It is selectively distributed into estrogen receptor (ER)-positive tissues such as ER-expressing tumors like those seen in breast and prostate cancers.{{cite journal | vauthors = Asai M, Takeuchi H, Okada H | title = In vivo interaction between steroidal alkylating agents and oestrogen receptors in rabbit uteri | journal = Acta Endocrinologica | volume = 87 | issue = 1 | pages = 173–180 | date = January 1978 | pmid = 579532 | doi = 10.1530/acta.0.0870173 }} For this reason, estradiol mustard and other cytostatic-linked estrogens like estramustine phosphate have reduced toxicity relative to non-linked nitrogen mustard cytostatic antineoplastic agents. However, they may stimulate breast tumor growth due to their inherent estrogenic activity and are said to be devoid of major therapeutic efficacy in breast cancer,{{cite journal | vauthors = Leclercq G, Devleeschouwer N, Heuson JC | title = Guide-lines in the design of new antiestrogens and cytotoxic-linked estrogens for the treatment of breast cancer | journal = Journal of Steroid Biochemistry | volume = 19 | issue = 1A | pages = 75–85 | date = July 1983 | pmid = 6887875 | doi = 10.1016/S0022-4731(83)80009-0| url = https://books.google.com/books?id=1VMJAwAAQBAJ&pg=PA75 |publisher=Elsevier Science|isbn=978-1-4831-9067-9 | veditors = James VH, Pasqualini JR }} although estramustine phosphate has been approved for and is used (almost exclusively) in the treatment of prostate cancer.{{cite book | vauthors = Scullin P, O'Sullivan JM, Parker CC | chapter = Strategies for the Implementation of Chemotherapy| veditors = Ablin RJ, Mason MD |title=Metastasis of Prostate Cancer| chapter-url= https://books.google.com/books?id=AAo2qVvcVJcC&pg=PA311 |date=5 September 2007|publisher=Springer Science & Business Media|isbn=978-1-4020-5847-9|pages=311–}}
See also
References
{{Reflist}}
{{Estradiol}}
{{Estrogen receptor modulators}}
Category:Chloroethyl compounds
{{Steroid-stub}}
{{Genito-urinary-drug-stub}}
{{Antineoplastic-drug-stub}}