Estromustine

{{Short description|Chemical compound}}

{{Distinguish|Estramustine phosphate|Estramustine}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,13S,14S)-13-Methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] N,N-bis(2-chloroethyl)carbamate

| image = Estromustine.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Chemotherapeutic agent; Estrogen; Estrogen ester

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life = 14 hours

| excretion =

| CAS_number_Ref =

| CAS_number = 62899-40-5

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 124946

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 111241

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = EoM; Leo 271 f; Estrone 17β-3-N-bis(2-chloroethyl)carbamate; Estrone–cytostatic complex

| C=23 | H=29 | Cl=2 | N=1 | O=3

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OC(=O)N(CCCl)CCCl

| StdInChI_Ref =

| StdInChI = 1S/C23H29Cl2NO3/c1-23-9-8-18-17-5-3-16(29-22(28)26(12-10-24)13-11-25)14-15(17)2-4-19(18)20(23)6-7-21(23)27/h3,5,14,18-20H,2,4,6-13H2,1H3/t18-,19-,20+,23+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = AXWYROHIFVWHMR-UGTOYMOASA-N

}}

Estromustine (developmental code name Leo 271 f), also known as estrone 17β-3-N-bis(2-chloroethyl)carbamate or estrone–cytostatic complex,{{cite journal | vauthors = Yamanaka H, Kitaura K, Imai K, Yuasa H, Nakai K, Matsumura Y, Uehara H, Shida K | title = In vivo studies of 3H-estramustine in castrated male rat | journal = Acta Urologica Japonica | date = 1981 | volume = 27 | issue = 3 | pages = 243–50 | url = http://repository.kulib.kyoto-u.ac.jp/dspace/handle/2433/122855}} is a major active metabolite of the cytostatic antineoplastic agent and estrogen estramustine phosphate, a medication used in the treatment of prostate cancer.{{cite book| vauthors = Chabner BA, Longo DL |title=Cancer Chemotherapy and Biotherapy: Principles and Practice|url=https://books.google.com/books?id=0U4aj4GZWCIC&pg=PA252|date=7 December 2011|publisher=Lippincott Williams & Wilkins|isbn=978-1-4511-4820-6|pages=252–}}{{cite book|title=Medical Subject Headings: Supplementary chemical records|url=https://books.google.com/books?id=oqttAAAAMAAJ|year=1993|publisher=The Library|page=684}}

See also

References