Estromustine
{{Short description|Chemical compound}}
{{Distinguish|Estramustine phosphate|Estramustine}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = [(8R,9S,13S,14S)-13-Methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] N,N-bis(2-chloroethyl)carbamate
| image = Estromustine.svg
| width = 250px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| class = Chemotherapeutic agent; Estrogen; Estrogen ester
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life = 14 hours
| excretion =
| CAS_number_Ref =
| CAS_number = 62899-40-5
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 124946
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 111241
| UNII =
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms = EoM; Leo 271 f; Estrone 17β-3-N-bis(2-chloroethyl)carbamate; Estrone–cytostatic complex
| C=23 | H=29 | Cl=2 | N=1 | O=3
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OC(=O)N(CCCl)CCCl
| StdInChI_Ref =
| StdInChI = 1S/C23H29Cl2NO3/c1-23-9-8-18-17-5-3-16(29-22(28)26(12-10-24)13-11-25)14-15(17)2-4-19(18)20(23)6-7-21(23)27/h3,5,14,18-20H,2,4,6-13H2,1H3/t18-,19-,20+,23+/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = AXWYROHIFVWHMR-UGTOYMOASA-N
}}
Estromustine (developmental code name Leo 271 f), also known as estrone 17β-3-N-bis(2-chloroethyl)carbamate or estrone–cytostatic complex,{{cite journal | vauthors = Yamanaka H, Kitaura K, Imai K, Yuasa H, Nakai K, Matsumura Y, Uehara H, Shida K | title = In vivo studies of 3H-estramustine in castrated male rat | journal = Acta Urologica Japonica | date = 1981 | volume = 27 | issue = 3 | pages = 243–50 | url = http://repository.kulib.kyoto-u.ac.jp/dspace/handle/2433/122855}} is a major active metabolite of the cytostatic antineoplastic agent and estrogen estramustine phosphate, a medication used in the treatment of prostate cancer.{{cite book| vauthors = Chabner BA, Longo DL |title=Cancer Chemotherapy and Biotherapy: Principles and Practice|url=https://books.google.com/books?id=0U4aj4GZWCIC&pg=PA252|date=7 December 2011|publisher=Lippincott Williams & Wilkins|isbn=978-1-4511-4820-6|pages=252–}}{{cite book|title=Medical Subject Headings: Supplementary chemical records|url=https://books.google.com/books?id=oqttAAAAMAAJ|year=1993|publisher=The Library|page=684}}
See also
References
{{Reflist}}
{{Estrogen receptor modulators}}
{{Androgen receptor modulators}}
Category:Chloroethyl compounds
Category:Human drug metabolites
{{Steroid-stub}}
{{Antineoplastic-drug-stub}}