Login
Login

Fluoride phosphate

{{short description|Class of chemical compounds}}

The fluoride phosphates or phosphate fluorides are inorganic double salts that contain both fluoride and phosphate anions. In mineralogy, Hey's Chemical Index of Minerals groups these as 22.1. The Nickel-Strunz grouping is 8.BN.

Related mixed anion compounds are the chloride phosphates, the fluoride arsenates and fluoride vanadates.

They are distinct from the fluorophosphates: monofluorophosphate, difluorophosphate and hexafluorophosphate which have fluorine bonds to the phosphorus.

Minerals

class="wikitable"

!name

!formula

!ratio

PO4:F

!formula weight

!crystal system

!space group

!unit cell

!volume

!density

!refractive index

!comment

!reference

Althausite

|Mg4(PO4)2(OH,O)(F,☐)

|2:~1

|

|Orthorhombic

|Pnma

|a = 8.258 b = 6.054, c = 14.383

|719.06

|2.97

|Biaxial (+) nα = 1.588 nβ = 1.592 nγ = 1.598

2V: measured: 70° , calculated: 80°

Max birefringence: δ = 0.010

|

|{{Cite web|title=Althausite: Mineral information, data and localities.|url=https://www.mindat.org/min-148.html|access-date=2020-06-03|website=www.mindat.org}}

Amblygonite

|LiAl(PO4)F

|1:1

|

|Triclinic

|P{{overbar|1}}

|a = 6.644 b = 7.744 c = 6.91

α = 90.35°, β = 117.33°, γ = 91.01° Z=4

|315.75

|3.04-3.11

|Biaxial (-) nα = 1.577 - 1.591 nβ = 1.592 - 1.605 nγ = 1.596 - 1.613

2V: Measured: 107° to 129.5°

Birefringence: 0.020

|

|{{Cite web|title=Amblygonite: Mineral information, data and localities.|url=https://www.mindat.org/min-189.html|access-date=2020-06-03|website=www.mindat.org}}

aravaite

|Ba2Ca18(SiO4)6(PO4)3(CO3)F3O

|3:3

|

|trigonal

|R{{overbar|3}}m

|a = 7.1255, c = 66.290 Z=3

|2914.8

|

|

|

|{{Cite journal|last1=Krüger|first1=Biljana|last2=Krüger|first2=Hannes|last3=Galuskin|first3=Evgeny V.|last4=Galuskina|first4=Irina O.|last5=Vapnik|first5=Yevgeny|last6=Olieric|first6=Vincent|last7=Pauluhn|first7=Anuschka|date=2018-12-01|title=Aravaite, Ba 2 Ca 18 (SiO 4 ) 6 (PO 4 ) 3 (CO 3 )F 3 O: modular structure and disorder of a new mineral with single and triple antiperovskite layers|url=http://scripts.iucr.org/cgi-bin/paper?S2052520618012271|journal=Acta Crystallographica Section B|volume=74|issue=6|pages=492–501|doi=10.1107/S2052520618012271|bibcode=2018AcCrB..74..492K |s2cid=104301273 |issn=2052-5206}}

Arctite

|Na2Ca4(PO4)3F

|3:1

|

|Trigonal

|R{{overbar|3}}m

|a = 7.078 c = 41.203 Z=6

|1,787.64

|3.13

|Uniaxial (-) nω = 1.578 nε = 1.577 Birefringence: 0.001

|

|{{Cite web|title=Arctite: Mineral information, data and localities.|url=https://www.mindat.org/min-316.html|access-date=2020-06-03|website=www.mindat.org}}

Ariegilatite

|BaCa12(SiO4)4(PO4)2F2O

|

|

|Trigonal

|R{{overbar|3}}m

|a = 7.1551 c = 41.303

|1381.2

|

|Uniaxial (-) nω = 1.650 nε = 1.647

Max Birefringence: δ = 0.003

|

|{{Cite web|title=Ariegilatite: Mineral information, data and localities.|url=https://www.mindat.org/min-51569.html|access-date=2020-06-03|website=www.mindat.org}}

Babefphite

|BaBePO4(F,OH)

|1:~1

|

|Tetragonal

|

|

|

|

|Uniaxial (+) nω = 1.629 nε = 1.632

Max birefringence: δ = 0.003

|

|{{Cite web|title=Babefphite: Mineral information, data and localities.|url=https://www.mindat.org/min-476.html|access-date=2020-06-03|website=www.mindat.org}}

Belovite-(Ce)

|NaCeSr3(PO4)3F

|3:1

|

|Trigonal

|P{{overbar|3}}

|a = 9.692 c = 7.201

|585.80

|4.19

|Uniaxial (-) nω = 1.653 - 1.660 nε = 1.634 - 1.640

Birefringence: 0.015

|

|{{Cite web|title=Belovite-(Ce): Mineral information, data and localities.|url=https://www.mindat.org/min-618.html|access-date=2020-06-03|website=www.mindat.org}}

Belovite-(La)

|NaLaSr3(PO4)3F

|3:1

|

|Trigonal

|P{{overbar|3}}

|a = 9.647 c = 7.17

|577.88

|4.19

|Uniaxial (-) nω = 1.653 nε = 1.635 - 1.636

Max birefringence: δ = 0.018

|

|{{Cite web|title=Belovite-(La): Mineral information, data and localities.|url=https://www.mindat.org/min-6822.html|access-date=2020-06-03|website=www.mindat.org}}

Bøggildite

|Na2Sr2Al2PO4F9

|1:9

|

|Monoclinic

|

|

|

|

|Biaxial (+) nα = 1.462 nβ = 1.466 nγ = 1.469

2V: 80° Max birefringence:δ = 0.007

|

|{{Cite web|title=Bøggildite: Mineral information, data and localities.|url=https://www.mindat.org/min-703.html|access-date=2020-06-03|website=www.mindat.org}}

Carlgieseckeite-(Nd)

|NaNdCa3(PO4)3F

|

|

|Trigonal

|P{{overbar|3}}

|a = 9.4553 c = 6.9825

|540.62

|3.91

|

|

|{{Cite web|title=Carlgieseckeite-(Nd): Mineral information, data and localities.|url=https://www.mindat.org/min-40295.html|access-date=2020-06-03|website=www.mindat.org}}

Cloncurryite

|Cu0.5(VO)0.5Al2(PO4)2F2 · 5H2O

|2:2

|

|Monoclinic

|P21/b

|a = 4.9573 b = 12.1824 c = 18.9749 β = 90.933° Z=4

|1145.78

|2.525

|Biaxial (-) nα = 1.548(2) nγ = 1.550(2)

2V: calculated: 56°

Max brefringence: δ = 0.002

|

|{{Cite web|title=Cloncurryite: Mineral information, data and localities.|url=https://www.mindat.org/min-29262.html|access-date=2020-06-04|website=www.mindat.org}}

Deloneite

|(Na0.5REE0.25Ca0.25)(Ca0.75REE0.25)Sr1.5(CaNa0.25REE0.25)(PO4)3F0.5(OH)0.5

|

|

|Trigonal

|P3

|a = 9.51 c = 7.01 Z=2

|549.05

|3.92

|Uniaxial (-) nω = 1.682 nε = 1.660

Max birefringence: δ = 0.022

|

|{{Cite web|title=Deloneite: Mineral information, data and localities.|url=https://www.mindat.org/min-6900.html|access-date=2020-06-03|website=www.mindat.org}}

Fluellite

|Al2(PO4)F2(OH) · 7H2O

|

|

|Orthorhombic

|Fddd

|a = 11.22 b = 21.15 c = 8.54

|2,027

|2.139 - 2.17

|Biaxial (+) nα = 1.473 - 1.490 nβ = 1.490 - 1.496 nγ = 1.506 - 1.511

Max birefringence: δ = 0.033

|

|{{Cite web|title=Fluellite: Mineral information, data and localities.|url=https://www.mindat.org/min-1565.html|access-date=2020-06-03|website=www.mindat.org}}

Fluorapatite

|Ca5(PO4)3F

|3:1

|

|Hexagonal

|P63/m

|a = 9.3973 c = 6.8782

|526.03

|3.1-3.25

|Uniaxial (-) nω = 1.631 - 1.650 nε = 1.627 - 1.646

Birefringence: 0.004

|

|{{Cite web|title=Fluorapatite: Mineral information, data and localities.|url=https://www.mindat.org/min-1572.html|access-date=2020-06-03|website=www.mindat.org}}

Fluorcaphite

|SrCaCa3(PO4)3F

|3:1

|

|Hexagonal

|P63/m

|a = 9.485 c = 7.000 Z=2

|545.39

|

|Uniaxial (-) nω = 1.649 nε = 1.637

Max birefringence: δ = 0.012

|

|{{Cite web|title=Fluorcaphite: Mineral information, data and localities.|url=https://www.mindat.org/min-6948.html|access-date=2020-06-03|website=www.mindat.org}}

Fluorphosphohedyphane

|Ca2Pb3(PO4)3F

|3:1

|

|Hexagonal

|P63/m

|a = 9.640, c = 7.012 Z=2

|564.4

|5.445

|Uniaxial (-) nω = 1.836 nε = 1.824

Max birefringence: δ = 0.012

|

|{{Cite web|title=Fluorphosphohedyphane: Mineral information, data and localities.|url=https://www.mindat.org/min-39334.html|access-date=2020-06-03|website=www.mindat.org}}

Fluorstrophite

|SrCaSr3(PO4)3F

|3:1

|

|Hexagonal

|P63/m

|a = 9.565 c = 7.115 Z=2

|563.74

|

|Uniaxial (-) nω = 1.651 nε = 1.637

Max birefringence: δ = 0.014

|

|{{Cite web|title=Fluorstrophite: Mineral information, data and localities.|url=https://www.mindat.org/min-3757.html|access-date=2020-06-03|website=www.mindat.org}}

Francolite

|

|

|

|

|

|

|

|

|

|

|

Herderite

|CaBe(PO4)F

|

|

|Monoclinic

|

|a = 4.81, b = 7.7 c = 9.82 β = 90.1°

|363.7

|3.02

|Biaxial (-) nα = 1.556 - 1.592 nβ = 1.578 - 1.610 nγ = 1.589 - 1.620

2V: calculated: 70°

Max birefringence: δ = 0.033

|

|{{Cite web|title=Herderite: Mineral information, data and localities.|url=https://www.mindat.org/min-1876.html|access-date=2020-06-03|website=www.mindat.org}}

Iangreyite

|Ca2Al7(PO4)2(PO3OH)2(OH,F)15 · 8H2O

|4:~15

|

|Trigonal

|P3 2 1

|a = 6.988 c = 16.707

|706.5

|

|

|

|{{Cite web|title=Iangreyite: Mineral information, data and localities.|url=https://www.mindat.org/min-39883.html|access-date=2020-06-03|website=www.mindat.org}}

Isokite

|CaMg(PO4)F

|

|

|Monoclinic

|B2/b

|a = 6.52 b = 8.75 c = 7.51 β = 121.47°

|365.4

|3.15-3.27

|Biaxial (+) nα = 1.590 nβ = 1.595 nγ = 1.615

2V: ,easured: 51°

Max birefringence: δ = 0.025

|

|{{Cite web|title=Isokite: Mineral information, data and localities.|url=https://www.mindat.org/min-2054.html|access-date=2020-06-03|website=www.mindat.org}}

Kingite

|Al3(PO4)2F2(OH) · 7H2O

|2:2

|

|Triclinic

|

|a = 9.15 b = 10 c = 7.24

α = 98.6°, β = 93.6°, γ = 93.2°

|

|

|Biaxial

|

|{{Cite web|title=Kingite: Mineral information, data and localities.|url=https://www.mindat.org/min-2210.html|access-date=2020-06-04|website=www.mindat.org}}

Kuannersuite-(Ce)

|NaCeBa3(PO4)3F0.5Cl0.5

|6:1

|

|Trigonal

|P{{overbar|3}}

|a = 9.909 c = 7.402

|629.42

|4.51

|

|

|{{Cite web|title=Kuannersuite-(Ce): Mineral information, data and localities.|url=https://www.mindat.org/min-25711.html|access-date=2020-06-03|website=www.mindat.org}}

Lacroixite

|NaAl(PO4)F

|1:1

|

|Monoclinic

|B2/b

|a = 6.414 b = 8.207 c = 6.885 β = 115.47°

|327.20

|3.126 - 3.29

|Biaxial (-) nα = 1.546 nβ = 1.563 nγ = 1.580

2V: measured: 89°

Birefringence: 0.034

|

|{{Cite web|title=Lacroixite: Mineral information, data and localities.|url=https://www.mindat.org/min-2310.html|access-date=2020-06-03|website=www.mindat.org}}

Mcauslanite

|Fe3Al2(PO4)3(PO3OH)F · 18H2O

|4:1

|

|Triclinic

|

|a = 10.05 b = 11.56 c = 6.88

α = 105.84°, β = 93.66°, γ = 106.47°

|728.7

|

|Biaxial (-) nα = 1.522 nβ = 1.531 nγ = 1.534

2V: measured: 55° to 59.7°, calculated: 58°

Max birefringence:δ = 0.012

|

|{{Cite web|title=Mcauslanite: Mineral information, data and localities.|url=https://www.mindat.org/min-2610.html|access-date=2020-06-03|website=www.mindat.org}}

Minyulite

|KAl2(PO4)2(OH,F) · 4H2O

|2:~1

|

|Orthorhombic

|Pba2

|a = 9.34 b = 9.74 c = 5.52

|502

|2.47

|Biaxial (+) nα = 1.531 nβ = 1.534 nγ = 1.538

2V: measured: 70° , calculated: 82°

Max birefringence: δ = 0.007

|

|{{Cite web|title=Minyulite: Mineral information, data and localities.|url=https://www.mindat.org/min-2724.html|access-date=2020-06-03|website=www.mindat.org}}

Miyahisaite

|(Sr,Ca)2Ba3(PO4)3F

|3:1

|

|Hexagonal

|P63/m

|a = 9.921, c = 7.469 Z=2

|636.7

|4.511

|

|

|{{Cite web|title=Miyahisaite: Mineral information, data and localities.|url=https://www.mindat.org/min-42835.html|access-date=2020-06-03|website=www.mindat.org}}

Morinite

|NaCa2Al2(PO4)2(OH)F4 · 2H2O

|2:4

|

|Monoclinic

|

|

|

|2.94

|Biaxial (-) nα = 1.551 nβ = 1.563 nγ = 1.565

2V: measured: 43° , calculated: 44°

Max birefringence: δ = 0.014

|

|{{Cite web|title=Morinite: Mineral information, data and localities.|url=https://www.mindat.org/min-2785.html|access-date=2020-06-03|website=www.mindat.org}}

Nacaphite

|Na2Ca(PO4)F

|

|

|Monoclinic

|P21/b

|a = 13.318 b = 7.0964 c = 10.6490 β = 113.526° Z=8

|922.81

|

|Biaxial (-) nα = 1.508 nβ = 1.515 nγ = 1.520

2V: 80° Max birefringence: δ = 0.012

|

|{{Cite web|title=Nacaphite: Mineral information, data and localities.|url=https://www.mindat.org/min-2824.html|access-date=2020-06-03|website=www.mindat.org}}

natrophosphate

|Na7(PO4)2F.19H2O

|2:1

|

|Isometric

|Fd3c

|a = 27.79 Z=56

|21,461.78

|1,71-1.72

|Isotropic

|

|{{cite journal|last1=Mitchell|first1=R. H.|date=5 July 2018|title=An ephemeral pentasodium phosphate carbonate from natrocarbonatite lapilli, Oldoinyo Lengai, Tanzania|journal=Mineralogical Magazine|volume=70|issue=2|pages=211–218|doi=10.1180/0026461067020326|s2cid=140140550}}{{Cite web|title=Natrophosphate: Mineral information, data and localities.|url=https://www.mindat.org/min-2862.html|access-date=2020-06-03|website=www.mindat.org}}

Nefedovite

|Na5Ca4(PO4)4F

|4:1

|

|Triclinic

|

|a = 5.4 Å, b = 11.64 Å, c = 16.48 Å

α = 134.99°, β = 90.04°, γ = 89.96°

|732.60

|

|Biaxial (+) nα = 1.571 nγ = 1.590

Max birefringence: δ = 0.019

|

|{{Cite web|title=Nefedovite: Mineral information, data and localities.|url=https://www.mindat.org/min-2870.html|access-date=2020-06-03|website=www.mindat.org}}

Nevadaite

|(Cu2+,Al,V3+)6Al8(PO4)8F8(OH)2 · 22H2O

|8:8

|

|Orthorhombic

|P21mn

|a = 12.123 b = 18.999 c = 4.961

|

|2.54

|Biaxial (-) nα = 1.540 nβ = 1.548 nγ = 1.553

2V: measured: 76°, calculated: 76°

Max birefringence: δ = 0.013

|

|{{Cite web|title=Nevadaite: Mineral information, data and localities.|url=https://www.mindat.org/min-25696.html|access-date=2020-06-04|website=www.mindat.org}}

Panasqueiraite

|CaMg(PO4)(OH,F)

|1:~1

|

|monoclinic

|

|a = 6.53 b = 8.75 c = 6.91 β = 112.33°

|365.2

|3.27

|Biaxial (+) nα = 1.590 nβ = 1.596 nγ = 1.616

2V: measured: 51° , calculated: 58°

Max birefringence: δ = 0.026

|

|{{Cite web|title=Panasqueiraite: Mineral information, data and localities.|url=https://www.mindat.org/min-3073.html|access-date=2020-06-03|website=www.mindat.org}}

Richellite

|CaFe3+2(PO4)2(OH,F)2

|2:~2

|

|

|

|a = 5.18 c = 12.61

|

|

|

|

|{{Cite web|title=Richellite: Mineral information, data and localities.|url=https://www.mindat.org/min-3413.html|access-date=2020-06-03|website=www.mindat.org}}

Stronadelphite

|Sr5(PO4)3F

|3:1

|

|Hexagonal

|P63/m

|a = 9.845 c = 7.383

|619.72

|

|Uniaxial (-) nω = 1.630(1) nε = 1.623(1)

Max birefringence: δ = 0.007

|

|{{Cite web|title=Stronadelphite: Mineral information, data and localities.|url=https://www.mindat.org/min-35973.html|access-date=2020-06-03|website=www.mindat.org}}

Triplite

|Mn2+2(PO4)F

|1:1

|

|Monoclinic

|P21/b

|a = 11.9 b = 6.52 c = 10.09 β = 105.62°

|758.4

|3.9

|Biaxial (+) nα = 1.650 nβ = 1.660 nγ = 1.680

2V: measured: 70° to 90°, calculated: 72°

Max birefringence: δ = 0.030

|

|{{Cite web|title=Triplite: Mineral information, data and localities.|url=https://www.mindat.org/min-4021.html|access-date=2020-06-03|website=www.mindat.org}}

Väyrynenite

|Mn2+Be(PO4)(OH,F)

|1:~1

|

|Monoclinic

|P21/b

|a = 5.411 b = 14.49 c = 4.73 β = 102.75°

|361.71

|3.22

|Biaxial (-) nα = 1.638 - 1.640 nβ = 1.658 - 1.662 nγ = 1.664 - 1.667

2V: measured: 46° to 55°, Calculated: 51° to 57°

Max birefringence: δ = 0.026 - 0.027

|

|{{Cite web|title=Väyrynenite: Mineral information, data and localities.|url=https://www.mindat.org/min-4220.html|access-date=2020-06-03|website=www.mindat.org}}

Viitaniemiite

|Na(Ca,Mn2+)Al(PO4)(F,OH)3

|1:~3

|

|Monoclinic

|

|a = 6.83 b = 7.14 c = 5.44 β = 109.37°

|250.27

|

|Biaxial (-) nα = 1.557 nβ = 1.565 nγ = 1.571

2V: measured: 81° , calculated: 80°

Max birefringence: δ = 0.014

|

|{{Cite web|title=Viitaniemiite: Mineral information, data and localities.|url=https://www.mindat.org/min-4178.html|access-date=2020-06-03|website=www.mindat.org}}

Wagnerite

|(Mg,Fe2+)2(PO4)F

|1:1

|

|Monoclinic

|P21/b

|a = 9.645 b = 31.659 c = 11.914 β = 108.26(3)°

|3454.8

|3.15

|Biaxial (+) nα = 1.568 nβ = 1.572 nγ = 1.582

2V: Measured: 25° to 35°

? Birefringence:0.046

Max birefringence: δ = 0.015

|

|{{Cite web|title=Wagnerite: Mineral information, data and localities.|url=https://www.mindat.org/min-4229.html|access-date=2020-06-03|website=www.mindat.org}}

Wavellite

|Al3(PO4)2(OH,F)3 · 5H2O

|2:~3

|

|Orthorhombic

|

|a = 9.621 b = 17.363 c = 6.994

|1168.3

|2.36

|Biaxial (+) nα = 1.518 - 1.535 nβ = 1.524 - 1.543 nγ = 1.544 - 1.561

2V: measured: 60° to 72°, calculated: 60° to 70°

Max birefringence: δ = 0.026

|

|{{Cite web|title=Wavellite: Mineral information, data and localities.|url=https://www.mindat.org/min-4250.html|access-date=2020-06-04|website=www.mindat.org}}

Zwieselite

|Fe2+2(PO4)F

|1:1

|

|Monoclinic

|P21/b

|

|753.82

|

|Biaxial (+) nα = 1.686 - 1.696 nβ = 1.690 - 1.704 nγ = 1.703 - 1.713

2V: measured: 58° , calculated: 60°

Max birefringence: δ = 0.017

|

|{{Cite web|title=Zwieselite: Mineral information, data and localities.|url=https://www.mindat.org/min-4436.html|access-date=2020-06-03|website=www.mindat.org}}

|Na5-4.5PO4(CO3,F,Cl)

|1:~1

|

|

|

|

|

|

|

|

|

Artificial

class="wikitable"

!name

!formula

!formula weight

!crystal system

!space group

!unit cell Å

!volume

!density

!refractive index

!comment

!reference

EMM-9; 4-(dimethylamino)pyridine fluoroaluminophosphate

|(DMAP)2Al4P4O17F2•H2O

|

|monoclinic

|P21/a

|a=14.335 b=13.561 c=14.497 β =101.094°

|

|

|

|layered

|{{Cite journal |last=Guo |first=Peng |last2=Afeworki |first2=Mobae |last3=Cao |first3=Guang |last4=Yun |first4=Yifeng |last5=Sun |first5=Junliang |last6=Su |first6=Jie |last7=Wan |first7=Wei |last8=Zou |first8=Xiaodong |date=2018-09-17 |title=Synthesis and Structure of a Layered Fluoroaluminophosphate and Its Transformation to a Three-Dimensional Zeotype Framework |url=https://pubs.acs.org/doi/10.1021/acs.inorgchem.8b01890 |journal=Inorganic Chemistry |language=en |volume=57 |issue=18 |pages=11753–11760 |doi=10.1021/acs.inorgchem.8b01890 |issn=0020-1669|url-access=subscription }}

|KBPO4F

|

|monoclinic

|Cc

|

|

|

|

|

|{{Cite journal |last=Ding |first=Qingran |last2=Zhao |first2=Sangen |last3=Li |first3=Lina |last4=Shen |first4=Yaoguo |last5=Shan |first5=Pai |last6=Wu |first6=Zhenyue |last7=Li |first7=Xianfeng |last8=Li |first8=Yanqiang |last9=Liu |first9=Shuai |last10=Luo |first10=Junhua |date=2019-02-04 |title=Abrupt Structural Transformation in Asymmetric ABPO 4 F (A = K, Rb, Cs) |url=https://pubs.acs.org/doi/10.1021/acs.inorgchem.8b02754 |journal=Inorganic Chemistry |language=en |volume=58 |issue=3 |pages=1733–1737 |doi=10.1021/acs.inorgchem.8b02754 |issn=0020-1669|url-access=subscription }}

Iron-Doped Sodium–Vanadium Fluorophosphate

|Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3)

|

|tetrahedral

|P42/mnm

|a=9.0277 c=10.6259

|866.0

|

|

|

|{{cite journal |last1=Palomares |first1=Verónica |last2=Iturrondobeitia |first2=Amaia |last3=Sanchez-Fontecoba |first3=Paula |last4=Goonetilleke |first4=Damian |last5=Sharma |first5=Neeraj |last6=Lezama |first6=Luis |last7=Rojo |first7=Teófilo |title=Iron-Doped Sodium–Vanadium Fluorophosphates: Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3)|journal=Inorganic Chemistry |date=16 December 2019 |volume=59 |issue=1 |pages=854–862 |doi=10.1021/acs.inorgchem.9b03111|pmid=31840984 |s2cid=209384135 }}

|Na3V2O1.6(PO4)2F1.4

|

|

|

|

|

|

|

|

|

|Na3V2(PO4)2F3

|

|

|

|

|

|

|

|

|{{Cite journal |last1=Semykina |first1=Daria O. |last2=Sharafutdinov |first2=Marat R. |last3=Kosova |first3=Nina V. |date=2022-06-24 |title=Understanding of the Mechanism and Kinetics of the Fast Solid-State Reaction between NaF and VPO 4 to Form Na 3 V 2 (PO 4 ) 2 F 3 |url=https://pubs.acs.org/doi/10.1021/acs.inorgchem.2c00951 |journal=Inorganic Chemistry |volume=61 |issue=26 |language=en |pages=10023–10035 |doi=10.1021/acs.inorgchem.2c00951 |pmid=35748412 |s2cid=249989441 |issn=0020-1669|url-access=subscription }}

|Na2MnPO4F

|

|

|

|

|

|

|

|

|{{Cite journal|last1=Kirsanova|first1=Maria A.|last2=Akmaev|first2=Alexey S.|last3=Aksyonov|first3=Dmitry A.|last4=Ryazantsev|first4=Sergey V.|last5=Nikitina|first5=Victoria A.|last6=Filimonov|first6=Dmitry S.|last7=Avdeev|first7=Maxim|last8=Abakumov|first8=Artem M.|date=2020-11-16|title=Monoclinic α-Na 2 FePO 4 F with Strong Antisite Disorder and Enhanced Na + Diffusion|url=https://pubs.acs.org/doi/10.1021/acs.inorgchem.0c01961|journal=Inorganic Chemistry|language=en|volume=59|issue=22|pages=16225–16237|doi=10.1021/acs.inorgchem.0c01961|pmid=33137251|s2cid=226241204 |issn=0020-1669|url-access=subscription}}

α

|Na2FePO4F

|

|monoclinic

|P21/c

|a = 13.675, b = 5.2503, c = 13.7202, β = 120.230°

|

|

|

|

|

β

|Na2FePO4F

|

|orthorhombic

|

|

|

|

|

|

|

|RbBPO4F

|210.25

|cubic

|P213

|a=7.5901 Z=4

|437.26

|3.194

|

|colourless

|

MIL-145

|RbGa3(PO4)2(HPO4)F4·C5N2H16·2H2O

|3187.11

|monoclinic

|P2

|a=14.4314 b=9.1152 c=16.7889 β = 112.708 Z=1

|2037.30

|2.598

|

|colourless

|{{Cite journal|last1=Martineau|first1=Charlotte|last2=Loiseau|first2=Thierry|last3=Beitone|first3=Lionel|last4=Férey|first4=Gérard|last5=Bouchevreau|first5=Boris|last6=Taulelle|first6=Francis|date=2013|title=Single-crystal XRD and solid-state NMR structural resolution of a layered fluorinated gallium phosphate: RbGa 3 (PO 4 ) 2 (HPO 4 )F 4 ·C 5 N 2 H 16 ·2H 2 O (MIL-145)|url=http://xlink.rsc.org/?DOI=C2DT31464A|journal=Dalton Trans.|language=en|volume=42|issue=2|pages=422–431|doi=10.1039/C2DT31464A|pmid=23069866 |issn=1477-9226|url-access=subscription}}

|K2SnPO4F3

|348.86

|monoclinic

|P21/c

|a=10.039 b=9.415 c=21.602 beta=95.464 Z=12

|2032.6

|3.420

|

|colourless

|{{Cite journal|last1=Hu|first1=Shuaishuai|last2=Su|first2=Zhi|date=2019|title=Two new tin( iv )-containing phosphate fluorides with two types of Sn( iv )–P–O–F frameworks and short cutoff edges|url=http://xlink.rsc.org/?DOI=C9NJ04424H|journal=New Journal of Chemistry|language=en|volume=43|issue=41|pages=16127–16130|doi=10.1039/C9NJ04424H|s2cid=203137437 |issn=1144-0546|url-access=subscription}}

|K6Sn(P2O7)2F2

|739.17

|monoclinic

|P21/c

|a=8.515 b=12.400 c=8.403 beta=99.58 Z=29

|874.8

|2.806

|

|colourless

|

|K2Sb(P2O7)F

|

|tetragonal

|P4bm

|a=8.5239 c=5.572 Z=2

|404.8

|3.223

|

|colourless SHG 4.0×KDP

|{{Cite journal|last1=Deng|first1=Yalan|last2=Huang|first2=Ling|last3=Dong|first3=Xuehua|last4=Wang|first4=Lei|last5=Ok|first5=Kang Min|last6=Zeng|first6=Hongmei|last7=Lin|first7=Zhien|last8=Zou|first8=Guohong|date=2020-11-16|title=K 2 Sb(P 2 O 7 )F: Cairo Pentagonal Layer with Bifunctional Genes Reveal Optical Performance|url=https://onlinelibrary.wiley.com/doi/10.1002/anie.202009441|journal=Angewandte Chemie International Edition|language=en|volume=59|issue=47|pages=21151–21156|doi=10.1002/anie.202009441|pmid=32745331 |s2cid=250308476 |issn=1433-7851|url-access=subscription}}

|CsBPO4F

|

|cubic

|P213

|a=7.7090 Z=4

|458.14

|3.736

|

|colourless

|

|Na2PrF2(PO4)

|

|cubic

|

|

|

|

|

|

|{{Cite journal |last1=Zimina |first1=G. V. |last2=Smirnova |first2=I. N. |last3=Gorkovenko |first3=M. Yu. |last4=Spiridonov |first4=F. M. |last5=Komissarova |first5=L. N. |last6=Kaloev |first6=N. I. |date=1995-02-21 |title=ChemInform Abstract: Synthesis and Studies of Fluorophosphates of Rare Earth Elements Na2LnF2PO4. |url=https://onlinelibrary.wiley.com/doi/10.1002/chin.199508015 |journal=ChemInform |language=en |volume=26 |issue=8 |doi=10.1002/chin.199508015 |issn=0931-7597|url-access=subscription }}

|Na2NdF2(PO4)

|

|cubic

|

|

|

|

|

|

|

|Na2SmF2(PO4)

|

|cubic

|

|

|

|

|

|

|

|Na2EuF2(PO4)

|

|cubic

|

|

|

|

|

|

|

|Na2TbF2(PO4)

|

|cubic

|

|

|

|

|

|

|

|Na2PrF2(PO4)

|

|cubic

|

|

|

|

|

|

|

|PbZn(PO4)F

|386.53

|orthorhombic

|Pna21

|a=8.985 b=9.381 c=4.8212 Z=4

|406.4

|6.318

|

|colourless

|{{Cite journal |last1=li |first1=xiaobao |last2=Hu |first2=Chun-Li |last3=Kong |first3=Fang |last4=Mao |first4=Jiang-Gao |date=2023 |title=Structure and Optical Property Evolutions in PbM(PO4)X (M = Zn, Sn; X = halogen): SHG Effect and Birefringence |journal=Inorganic Chemistry Frontiers |volume=10 |issue=8 |language=en |pages=2268–2275 |doi=10.1039/D3QI00230F |s2cid=257419074 |issn=2052-1553|doi-access=free }}

References

{{Reflist}}

Category:Fluorides

Category:Phosphates

Category:Mixed anion compounds