HEPES

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 448969371

| Name = HEPES

| ImageFile = HEPES.png

| ImageName = chemical structure of HEPES

| ImageClass = skin-invert

| PIN = 2-[4-(2-Hydroxyethyl)piperazin-1-yl]ethane-1-sulfonic acid

| OtherNames = HEPES

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 22278

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RWW266YE9I

| InChI = 1/C8H18N2O4S/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14/h11H,1-8H2,(H,12,13,14)

| InChIKey = JKMHFZQWWAIEOD-UHFFFAOYAC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8H18N2O4S/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14/h11H,1-8H2,(H,12,13,14)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JKMHFZQWWAIEOD-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 7365-45-9

| CASNo_Comment = (free acid)

| CASNo2_Ref = {{cascite|unknown|CAS}}

| CASNo2 = 75277-39-3

| CASNo2_Comment = (sodium salt)

| RTECS = TL6809000

| EINECS = 230-907-9

| Beilstein = 883043

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 42334

| SMILES = OCCN1CC[NH+](CCS(=O)([O-])=O)CC1

| PubChem = 23831

}}

|Section2={{Chembox Properties

| C=8 | H=18 | N=2 | O=4 | S=1

| MolarMass = 238.3012 g/mol

| Appearance = white crystalline powder

| Density = Not applicable

| Solubility = 40 g/100 ml (20°C)

| MeltingPt = >234-238°C (453-457K)

| pKa = 3 (pK_a1),
7.5 (pK_a2){{cite journal |vauthors = Johnson MA, Seifert S, Petrache HI, Kimble-Hill AC |date= 2014|title= Phase Coexistence in Single-Lipid Membranes Induced by Buffering Agents|journal= Langmuir|volume= 30|issue= 33|pages= 9880-9885|doi= 10.1021/la5018938 |pmc=4148158|access-date=}}

}}

|Section7={{Chembox Hazards

| ExternalSDS = [https://www.sigmaaldrich.com/US/en/product/sigma/h3375]

| MainHazards = Eye Irritant

| NFPA-H = 1

| NFPA-F = 0

| NFPA-R = 1

| FlashPt = Non-flammable

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|270|271|280|301+312|302+352|304+312|304+340|305+351+338|312|321|322|330|332+313|337+313|362|363|403+233|405|501}}

}}

}}

HEPES (4-(2-hydroxyethyl)-1-piperazineethanesulfonic acid) is a zwitterionic sulfonic acid buffering agent. It is one of the twenty Good's buffers. HEPES is widely used in cell culture, largely because it is better at maintaining physiological pH despite changes in carbon dioxide concentration (produced by aerobic respiration) when compared to bicarbonate buffers, which are also commonly used in cell culture. {{cite journal |vauthors=Baicu SC, Taylor MJ | title=Acid-base buffering in organ preservation solutions as a function of temperature: new parameters for comparing buffer capacity and efficiency | journal=Cryobiology | volume=45 | issue=1 | year=2002 | pages=33–48 | pmid=12445548 | doi=10.1016/S0011-2240(02)00104-9}} Lepe-Zuniga et al. reported an unwanted photochemical process wherein HEPES catalyzes a reaction with riboflavin when exposed to ambient light to produce hydrogen peroxide.{{cite journal |vauthors=Lepe-Zuniga JL, Zigler JS, Gery I |title=Toxicity of light-exposed Hepes media |journal= Journal of Immunological Methods|volume=103 |issue=1 |pages=145 |date=October 1987 |pmid=3655381 |doi=10.1016/0022-1759(87)90253-5 |url=http://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+hsdb:@term+@rn+7722-84-1}}{{cite journal |vauthors=Zigler JS, Lepe-Zuniga JL, Vistica B, Gery I |title=Analysis of the cytotoxic effects of light-exposed HEPES-containing culture medium|journal= In Vitro Cellular & Developmental Biology|volume=21 |issue=5 |pages=282–7 |date=May 1985 |pmid=4019356 |doi=10.1007/BF02620943 |s2cid=6557697 |url=http://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+hsdb:@term+@rn+7722-84-1}} This is not a problem in bicarbonate-based cell culture buffers. It is therefore strongly advised to keep solutions containing both HEPES and riboflavin in darkness as much as possible to prevent oxidation.

HEPES has the following characteristics:

• pK_a1 (25 °C) = 3
• pK_a2 (25 °C) = 7.5
• Useful pH range = 2.5 to 3.5 or 6.8 to 8.2

HEPES has negligible metal ion binding,{{cite web |url=https://www.hopaxfc.com/en/blog/biological-buffers-and-their-interactions-with-metal-ions|title=Hopax Fine Chemicals - Biological buffers and their interactions with metal ions}} making it a good choice as a buffer for enzymes which might be inhibited by metal chelation.