MDMB-BINACA

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| IUPAC_name = methyl (2S)-2-[(1-butylindazole-3-carbonyl)amino]-3,3-dimethylbutanoate

| image = MDMB-BUTINACA_structure.png

| image_class = skin-invert-image

| width = 200px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_DE =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number =

| ATC_prefix =

| ATC_suffix =

| PubChem = 165361538

| ChemSpiderID = 79413388

| UNII = AN7ERQ8YHM

| smiles = CCCCN1C2=CC=CC=C2C(=N1)C(=O)N[C@H](C(=O)OC)C(C)(C)C

| C=19 | H=27 | N=3 | O=3

| StdInChI = 1S/C19H27N3O3/c1-6-7-12-22-14-11-9-8-10-13(14)15(21-22)17(23)20-16(18(24)25-5)19(2,3)4/h8-11,16H,6-7,12H2,1-5H3,(H,20,23)/t16-/m1/s1

| StdInChIKey = YHAWFWPNIXPRDT-MRXNPFEDSA-N

}}

MDMB-BINACA (MDMB-BUTINACA) is an indazole-3-carboxamide based synthetic cannabinoid receptor agonist that has been sold as a designer drug, first identified in Sweden in May 2023. It has a similar chemical structure to potent cannabinoid agonists previously reported such as ADB-BUTINACA and MDMB-5'Br-BUTINACA, and is believed to have similar effects.{{cite web | url = https://www.euda.europa.eu/sites/default/files/pdf/31883_en.pdf?606797 | title = New psychoactive substances - the current situation in Europe | work = European Drug Report | publisher = European Union Drugs Agency (EUDA) | date = 2024 }}