Meclofenoxate

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 451505829

| IUPAC_name = 2-Dimethylaminoethyl (4-chlorophenoxy)acetate

| image = Meclofenoxate.svg

| image_class = skin-invert-image

| width = 250

| tradename =

| Drugs.com = {{drugs.com|international|meclofenoxate}}

| legal_BR = C1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_US = Not FDA approved

| legal_status = Rx-only

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 51-68-3

| ATC_prefix = N06

| ATC_suffix = BX01

| PubChem = 4039

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = C76QQ2I0RG

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00993

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 3899

| C=12 | H=16 | Cl=1 | N=1 | O=3

| smiles = Clc1ccc(cc1)OCC(=O)OCCN(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C12H16ClNO3/c1-14(2)7-8-16-12(15)9-17-11-5-3-10(13)4-6-11/h3-6H,7-9H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XZTYGFHCIAKPGJ-UHFFFAOYSA-N

}}

Meclofenoxate (INN, BAN; brand name Lucidril, also known as centrophenoxine) is a cholinergic nootropic used as a dietary supplement.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA758|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=758–}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA636|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=636–}}{{cite journal | vauthors = Cohen PA, Avula B, Khan I | title = The unapproved drug centrophenoxine (meclofenoxate) in cognitive enhancement dietary supplements | journal = Clinical Toxicology | volume = 60 | issue = 10 | pages = 1156–1158 | date = October 2022 | pmid = 35959800 | doi = 10.1080/15563650.2022.2109485 | s2cid = 251516603 }} It is an ester of dimethylethanolamine (DMAE) and 4-chlorophenoxyacetic acid (pCPA).

In elderly patients, meclofenoxate has been shown to improve performance on certain memory tests.{{cite journal | vauthors = Marcer D, Hopkins SM | title = The differential effects of meclofenoxate on memory loss in the elderly | journal = Age and Ageing | volume = 6 | issue = 2 | pages = 123–31 | date = May 1977 | pmid = 329662 | doi = 10.1093/ageing/6.2.123 | doi-access = free }} Meclofenoxate also increases cellular membrane phospholipids.{{Citation needed|date=August 2010}} It is sold in Japan and some European countries, such as Germany, Hungary, and Austria, as a prescription drug.