Phyllodulcin
{{chembox
| Watchedfields = changed
| verifiedrevid = 442172331
| Name = Phyllodulcin
| ImageFile = Phyllodulcin.svg
| ImageSize = 200px
| ImageName = Chemical structure of phyllodulcin
| ImageAlt = Chemical structure of hyllodulcin
| PIN = (3R)-8-Hydroxy-3-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-1H-2-benzopyran-1-one
| OtherNames = Praeruptorin
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 21499-23-0
| CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9DDW04R41V
| PubChem = 146694
| ChemSpiderID = 129391
| SMILES = COc1ccc(cc1O)[C@H]2Cc3cccc(c3C(=O)O2)O
| StdInChI = 1S/C16H14O5/c1-20-13-6-5-9(7-12(13)18)14-8-10-3-2-4-11(17)15(10)16(19)21-14/h2-7,14,17-18H,8H2,1H3/t14-/m1/s1
| StdInChIKey = PBILBHLAPJTJOT-CQSZACIVSA-N
| MeSHName =
}}
|Section2={{Chembox Properties
| Formula = C16H14O5
| MolarMass = 286.27 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Phyllodulcin is a dihydroisocoumarin found in Hydrangea macrophyllaEffects of phyllodulcin, hydrangenol, and their 8-O-glucosides, and Thunberginols A and F from Hydrangea macrophylla SERINGE var. thunbergii MAKINO on passive cutaneous anaphylaxis reaction in rats. Matsuda H., Shimoda H., Yamahara J. and Yoshikawa M., Biological & pharmaceutical bulletin, 1999, vol. 22, no. 8, pp. 870–872, {{INIST|1959604}}. and Hydrangea serrata.Accumulation of phyllodulcin in sweet-leaf plants of Hydrangea serrata and its neutrality in the defence against a specialist leafmining herbivore. Mami Ujihara, Masateru Shinozaki and Makoto Kato, Researches on population ecology, Volume 37, Number 2, pp. 249–257, {{doi|10.1007/BF02515827}}. It is a sweetener 400–800 times sweeter than sugar.Chemical and Functional Properties of Food Saccharides. P. Tomasik, CRC Press, Boca Raton, 2003, {{ISBN|978-0-8493-1486-5}}.
See also
References
{{reflist}}
External links
- {{Commons category-inline}}
{{Isocoumarin}}
{{Food Substitutes}}
{{aromatic-stub}}