Pyriprole

{{Short description|Chemical compound}}

{{More citations needed|date=October 2013}}

{{Use dmy dates|date=December 2024}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444077120

| image = Pyriprole.svg

| width = 220

| alt =

| image2 = Pyriprole 3D ball.png

| alt2 = Ball-and-stick model of the pyriprole molecule

| pronounce =

| tradename = Prac-tic

| Drugs.com =

| MedlinePlus =

| DailyMedID =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration = Topical

| class = Ectoparasiticide

| ATCvet = yes

| ATC_prefix = P53

| ATC_suffix = AX26

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment = {{cite web | title=Prac-tic EPAR | website=European Medicines Agency (EMA) | date=18 December 2006 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/prac-tic | access-date=26 December 2024}}{{cite web | title=Prac-tic PI | website=Union Register of medicinal products | date=20 December 2006 | url=https://ec.europa.eu/health/documents/community-register/html/v066.htm | access-date=26 December 2024}}

| legal_UN =

| legal_UN_comment =

| legal_status =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 394730-71-3

| PubChem = 12056859

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 11677344

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 69OX73ZVJN

| KEGG = C18580

| ChEBI = 81845

| IUPAC_name = 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(difluoromethyl)thio]-5-[(2-pyridinylmethyl)amino]-1H-pyrazole-3-carbonitrile

| C=18 | H=10 | Cl=2 | F=5 | N=5 | S=1

| smiles = Clc2cc(C(F)(F)F)cc(Cl)c2-n(nc(C#N)c1SC(F)F)c1NCc3ncccc3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI=1S/C18H10Cl2F5N5S/c19-11-5-9(18(23,24)25)6-12(20)14(11)30-16(28-8-10-3-1-2-4-27-10)15(31-17(21)22)13(7-26)29-30/h1-6,17,28H,8H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MWMQNVGAHVXSPE-UHFFFAOYSA-N

| melting_point =

}}

Pyriprole, sold under the brand name Prac-tic, is a veterinary medication used for dogs against external parasites such as fleas and ticks.{{cite book | vauthors = Page SW | chapter = Antiparasitic Drugs | veditors = Maddison JE, Page SW, Church DB |title=Small Animal Clinical Pharmacology |date=2008 |publisher=Elsevier Health Sciences |location=[Edinburgh] |isbn=978-0-7020-2858-8 | pages = 198–260 (229) |edition=Second |chapter-url=https://books.google.com/books?id=RpsROVqemk8C&dq=Pyriprole&pg=PA229 | doi = 10.1016/B978-070202858-8.50012-9 }}{{cite book | vauthors = Londershausen M, Hansen O | chapter = Ectoparasiticides – Antagonists and Modulators of Chloride Channels |veditors = Mehlhorn H |title=Encyclopedia of Parasitology |date=2008 |publisher=Springer Rechtswissenschaft |location=Berlin |isbn=978-3-540-48994-8 |page=431 |edition=3rd | chapter-url=https://books.google.com/books?id=Jpg1ysgVn-AC&dq=Pyriprole&pg=PA431}}

Pyriprole is a phenylpyrazole derivative similar to fipronil.{{cn|date=December 2024}} Although introduced (in the 2000s) and under patent protection it is a "classic" insecticide.{{cn|date=December 2024}}{{clarify|date=October 2013}} It is only approved in the EU and a few other countries for use on dogs.{{cn|date=December 2024}} It is not approved for use on cats or livestock.{{cn|date=December 2024}} It has not been introduced as an agricultural or hygiene pesticide.{{cn|date=December 2024}}

Pyriprole applied as a spot-on is highly effective against fleas and several ticks species.{{cn|date=December 2024}} Efficacy against fleas is comparable to that of other modern insecticidal active ingredients such as fipronil, imidacloprid or spinosad.{{cn|date=December 2024}} As most flea spot-ons it controls existing flea and tick infestations in about 1 to 2 days, and provides about 4 weeks protection against re-infestations.{{cn|date=December 2024}}