Pyriprole

{{Short description|Chemical compound}}

{{More citations needed|date=October 2013}}

{{Use dmy dates|date=December 2024}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444077120

| image = Pyriprole.svg

| width = 220

| alt =

| image2 = Pyriprole 3D ball.png

| alt2 = Ball-and-stick model of the pyriprole molecule

| pronounce =

| tradename = Prac-tic

| Drugs.com =

| MedlinePlus =

| DailyMedID =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration = Topical

| class = Ectoparasiticide

| ATCvet = yes

| ATC_prefix = P53

| ATC_suffix = AX26

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment = {{cite web | title=Prac-tic EPAR | website=European Medicines Agency (EMA) | date=18 December 2006 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/prac-tic | access-date=26 December 2024}}{{cite web | title=Prac-tic PI | website=Union Register of medicinal products | date=20 December 2006 | url=https://ec.europa.eu/health/documents/community-register/html/v066.htm | access-date=26 December 2024}}

| legal_UN =

| legal_UN_comment =

| legal_status =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 394730-71-3

| PubChem = 12056859

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 11677344

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 69OX73ZVJN

| KEGG = C18580

| ChEBI = 81845

| IUPAC_name = 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(difluoromethyl)thio]-5-[(2-pyridinylmethyl)amino]-1H-pyrazole-3-carbonitrile

| C=18 | H=10 | Cl=2 | F=5 | N=5 | S=1

| smiles = Clc2cc(C(F)(F)F)cc(Cl)c2-n(nc(C#N)c1SC(F)F)c1NCc3ncccc3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI=1S/C18H10Cl2F5N5S/c19-11-5-9(18(23,24)25)6-12(20)14(11)30-16(28-8-10-3-1-2-4-27-10)15(31-17(21)22)13(7-26)29-30/h1-6,17,28H,8H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MWMQNVGAHVXSPE-UHFFFAOYSA-N

| melting_point =

}}

Pyriprole, sold under the brand name Prac-tic, is a veterinary medication used for dogs against external parasites such as fleas and ticks.{{cite book | vauthors = Page SW | chapter = Antiparasitic Drugs | veditors = Maddison JE, Page SW, Church DB |title=Small Animal Clinical Pharmacology |date=2008 |publisher=Elsevier Health Sciences |location=[Edinburgh] |isbn=978-0-7020-2858-8 | pages = 198–260 (229) |edition=Second |chapter-url=https://books.google.com/books?id=RpsROVqemk8C&dq=Pyriprole&pg=PA229 | doi = 10.1016/B978-070202858-8.50012-9 }}{{cite book | vauthors = Londershausen M, Hansen O | chapter = Ectoparasiticides – Antagonists and Modulators of Chloride Channels |veditors = Mehlhorn H |title=Encyclopedia of Parasitology |date=2008 |publisher=Springer Rechtswissenschaft |location=Berlin |isbn=978-3-540-48994-8 |page=431 |edition=3rd | chapter-url=https://books.google.com/books?id=Jpg1ysgVn-AC&dq=Pyriprole&pg=PA431}}

Pyriprole is a phenylpyrazole derivative similar to fipronil.{{cn|date=December 2024}} Although introduced (in the 2000s) and under patent protection it is a "classic" insecticide.{{cn|date=December 2024}}{{clarify|date=October 2013}} It is only approved in the EU and a few other countries for use on dogs.{{cn|date=December 2024}} It is not approved for use on cats or livestock.{{cn|date=December 2024}} It has not been introduced as an agricultural or hygiene pesticide.{{cn|date=December 2024}}

Pyriprole applied as a spot-on is highly effective against fleas and several ticks species.{{cn|date=December 2024}} Efficacy against fleas is comparable to that of other modern insecticidal active ingredients such as fipronil, imidacloprid or spinosad.{{cn|date=December 2024}} As most flea spot-ons it controls existing flea and tick infestations in about 1 to 2 days, and provides about 4 weeks protection against re-infestations.{{cn|date=December 2024}}

Mechanism of action

{{unreferenced section|date=December 2024}}

Pyriprole is an insecticide and acaricide. It inhibits γ-aminobutyric acid (GABA)-gated chloride channels (GABAA receptors) resulting in uncontrolled hyperactivity of the central nervous system of fleas and ticks.

Parasites are killed through contact rather than by systemic exposure. Following topical administration pyriprole is rapidly distributed in the hair coat of dogs within one day after application. It can be found in the hair coat throughout the treatment interval. Insecticidal efficacy duration against new infestations with fleas persists for a minimum of four weeks. The substance can be used as part of a treatment strategy for the control of flea allergy dermatitis (FAD).

References