cericlamine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 3-(3,4-Dichlorophenyl)-2-(dimethylamino)-2-methylpropan-1-ol

| image = Cericlamine.svg

| image_class = skin-invert-image

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Oral{{cite journal| vauthors = Darcourt G, Tessera M, Lesaunier R, Engrand P, Scherrer B, Dreyfus J, Bogaievsky Y |title=A Multicentre Double-Blind, Placebo-Controlled Dose-Finding Study with Cericlamine in Major Depression|journal=Clinical Neuropharmacology|volume=15|year=1992|pages=176B|issn=0362-5664|doi=10.1097/00002826-199202001-00339|s2cid=57983762}}

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life = 8 hours

| excretion =

| CAS_number_Ref =

| CAS_number = 112922-55-1

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = VES82D23IB

| ATC_prefix = None

| ATC_suffix =

| PubChem = 131074

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 115890

| synonyms = JO-1017

| C=12 | H=17 | Cl=2 | N=1 | O=1

| smiles = CC(CC1=CC(=C(C=C1)Cl)Cl)(CO)N(C)C

| StdInChI = 1S/C12H17Cl2NO/c1-12(8-16,15(2)3)7-9-4-5-10(13)11(14)6-9/h4-6,16H,7-8H2,1-3H3

| StdInChIKey = FWYRGHMKHZXXQX-UHFFFAOYSA-N

}}

Cericlamine (INN; developmental code JO-1017) is a potent and moderately selective serotonin reuptake inhibitor (SSRI) of the amphetamine family (specifically, a derivative of phentermine, and closely related to chlorphentermine, a highly selective serotonin releasing agent) that was investigated as an antidepressant for the treatment of depression, anxiety disorders, and anorexia nervosa by Jouveinal but did not complete development and was never marketed.{{cite journal | vauthors = Crow S, Brown E | title = Investigational drugs for eating disorders | journal = Expert Opinion on Investigational Drugs | volume = 12 | issue = 3 | pages = 491–9 | date = March 2003 | pmid = 12605570 | doi = 10.1517/13543784.12.3.491 | s2cid = 25463729 }}{{cite book| vauthors = Patel RM |title=Stereoselective Biocatalysis|url=https://books.google.com/books?id=QwgCzKDfNAoC&pg=PA48|date=3 January 2000|publisher=CRC Press|isbn=978-0-8247-8282-5|pages=48–}}{{cite book| vauthors = Tang LC, Tang SJ |title=Neurochemistry in Clinical Application|url=https://books.google.com/books?id=d2DlBwAAQBAJ&pg=PA81|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-1-4615-1857-0|pages=81–}} It reached phase III clinical trials in 1996 before development was discontinued in 1999.{{cite web | title = Cericlamine | work = AdisInsight | publisher = Springer Nature Switzerland AG | access-date = 13 January 2016 | url = http://adisinsight.springer.com/drugs/800001340}}

According to Czech scientists, cericlamine is claimed to be part of a highly advanced “fifth generation” of antidepressants as was venlafaxine.{{cite journal|pmid=8174184 |date=1994 |last1=Svestka |first1=J. |title=Antidepressives of the 3rd, 4th and 5th generation |journal=Ceskoslovenska Psychiatrie |volume=90 |issue=1 |pages=3–19 }}

The daily dosage was reported to be 300mg.