clostebol propionate

{{Short description|Chemical compound}}

{{Distinguish|Clobetasol propionate}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,10R,13S,14S,17S)-4-Chloro-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] propanoate

| image = Clostebol propionate.svg

| width = 250px

| image2 = Clostebol propionate molecule ball.png

| width2 = 250px

| tradename = Yonchlon

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 2162-44-9

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 71586790

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 32698327

| UNII = 7JJ3052NOU

| KEGG =

| ChEBI =

| ChEMBL =

| C=22 | H=31 | Cl=1 | O=3

| SMILES = CCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C(C(=O)CC[C@]34C)Cl)C

| StdInChI_Ref =

| StdInChI = 1S/C22H31ClO3/c1-4-19(25)26-18-8-7-14-13-5-6-16-20(23)17(24)10-12-21(16,2)15(13)9-11-22(14,18)3/h13-15,18H,4-12H2,1-3H3/t13-,14-,15-,18-,21+,22-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = WNUBDFJMQBMNQB-DXODLALXSA-N

| synonyms =

}}

Clostebol propionate (brand name Yonchlon), also known as 4-chlorotestosterone 17β-propionate or as 4-chloroandrost-4-en-17β-ol-3-one 17β-propionate, is a synthetic, injected anabolic-androgenic steroid (AAS) and a derivative of testosterone.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA305|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=305–}}{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=mqaOMOtk61IC&pg=PA80|date=31 October 1999|publisher=Springer Science & Business Media|isbn=978-0-7514-0499-9|pages=80–}} It is an androgen ester – specifically, the C17β propionate ester of clostebol (4-chlorotestosterone) – and acts as a prodrug of clostebol in the body.{{Additional citation needed|date=November 2016}} Clostebol acetate is administered via intramuscular injection.{{relevance inline|reason=Describing another substance|date=February 2025}}