famprofazone
{{Short description|NSAID analgesic medication}}
{{Drugbox
| IUPAC_name = 1-methyl-5-{[methyl(1-phenylpropan-2-yl)amino]methyl}-2-phenyl-4-(propan-2-yl)-1,2-dihydro-3H-pyrazol-3-one
| image = Famprofazone.png
| image_class = skin-invert-image
| tradename =
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = Oral
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 22881-35-2
| ATC_prefix = none
| ATC_suffix =
| PubChem = 3326
| ChemSpiderID = 3209
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = HN0NCX453C
| ChEMBL = 1475693
| C=24 | H=31 | N=3 | O=1
| smiles = O=C2\C(=C(/N(N2c1ccccc1)C)CN(C(C)Cc3ccccc3)C)C(C)C
}}
Famprofazone (Gewodin, Gewolen) is a nonsteroidal anti-inflammatory agent (NSAID) of the pyrazolone series which is available over-the-counter in some countries such as Taiwan.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | pages = 1932 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&q=famprofazone&pg=PA426}}{{cite book | vauthors = Hall JA, Morton I | title = Concise dictionary of pharmacological agents: properties and synonyms | publisher = Kluwer Academic | year = 1999 | pages = 342 | isbn = 0-7514-0499-3 | url = https://books.google.com/books?id=mqaOMOtk61IC&q=famprofazone&pg=PA118}}{{cite journal | vauthors = Chan KH, Hsu MC, Tseng CY, Chu WL | title = Famprofazone use can be misinterpreted as methamphetamine abuse | journal = Journal of Analytical Toxicology | volume = 34 | issue = 6 | pages = 347–353 | year = 2010 | pmid = 20663288 | doi = 10.1093/jat/34.6.347 | doi-access = }} It has analgesic, anti-inflammatory, and antipyretic effects. Famprofazone has been known to produce methamphetamine as an active metabolite, with 15–20% of an oral dose being converted to it.{{cite journal | vauthors = Oh ES, Hong SK, Kang GI | title = Plasma and urinary concentrations of methamphetamine after oral administration of famprofazone to man | journal = Xenobiotica; the Fate of Foreign Compounds in Biological Systems | volume = 22 | issue = 3 | pages = 377–384 | date = March 1992 | pmid = 1496827 | doi = 10.3109/00498259209046649 }}{{cite journal | vauthors = Shin HS, Park BB, Choi SN, Oh JJ, Hong CP, Ryu H | title = Identification of new urinary metabolites of famprofazone in humans | journal = Journal of Analytical Toxicology | volume = 22 | issue = 1 | pages = 55–60 | year = 1998 | pmid = 9491970 | doi = 10.1093/jat/22.1.55 | doi-access = free }} As a result, famprofazone has occasionally been implicated in causing positives on drug tests for amphetamines.
See also
References
{{reflist|30em}}
{{Anti-inflammatory products}}
{{Analgesics}}
{{Monoamine releasing agents}}
{{Xenobiotic-sensing receptor modulators}}
{{Phenethylamines}}
Category:Nonsteroidal anti-inflammatory drugs