hexestrol dipropionate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [4-[4-(4-propanoyloxyphenyl)hexan-3-yl]phenyl] propanoate

| image = Hexestrol dipropionate.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 4825-53-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 87WC4ICV8O

| ATC_prefix =

| ATC_suffix =

| PubChem = 107342

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 96605

| ChEMBL = 1577591

| C=24 | H=30 | O=4

| smiles = CCC(C1=CC=C(C=C1)OC(=O)CC)C(CC)C2=CC=C(C=C2)OC(=O)CC

| StdInChI_Ref =

| StdInChI = 1S/C24H30O4/c1-5-21(17-9-13-19(14-10-17)27-23(25)7-3)22(6-2)18-11-15-20(16-12-18)28-24(26)8-4/h9-16,21-22H,5-8H2,1-4H3

| StdInChIKey_Ref =

| StdInChIKey = HZLYMVNJKHJFRO-UHFFFAOYSA-N

| synonyms = Hexestrol 4,4'-dipropionate

}}

Hexestrol dipropionate (brand name Hexanoestrol, Retalon Oleosum), or hexestrol dipropanoate, is a synthetic, nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol.{{cite book | doi=10.1007/978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA129 | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer | date=14 November 2014 | veditors = Elks J, Ganellin CR, Elks J | page=163 | isbn=978-1-4757-2085-3 | oclc=898564124}} It is an ester of hexestrol, and has been known since at least 1931.{{cite book | url=https://books.google.com/books?id=AAVJAQAAIAAJ | title=Report | publisher=U.S. Government Printing Office | year=1931 | page=104 | lccn=sn85063598}} The drug has been used in the past to inhibit lactation in women.{{cite journal | vauthors = Prescott F, Basden M | title = Inhibition of Lactation by Hexoestrol Dipropionate | journal = British Medical Journal | volume = 2 | issue = 4369 | pages = 428–30 | date = September 1944 | pmid = 20785672 | pmc = 2286347 | doi = 10.1136/bmj.2.4369.428 }}{{cite book | url=https://books.google.com/books?id=orTyAAAAMAAJ | title=Journal of Clinical Endocrinology | veditors = Thomas CC | year=1945 | page=194 | issn=0368-1610 | lccn=45029631 | oclc=1607514}}

{{Parenteral potencies and durations of nonsteroidal estrogens}}