melitracen
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 462248286
| IUPAC_name = 3-(10,10-dimethylanthracen-9(10H)-ylidene)-N,N-dimethylpropan-1-amine
| image = Melitracen.svg
| image_class = skin-invert-image
| alt = Skeletal formula of melitracen
| width = 190
| image2 = Melitracen-3D-balls.png
| alt2 = Ball-and-stick model of the melitracen molecule
| tradename = Adaptol, Dixeran, Melixeran, Thymeol, Trausabun
| Drugs.com = {{drugs.com|international|melitracen}}
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = Oral, intramuscular injection
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 5118-29-6
| ATC_prefix = N06
| ATC_suffix = AA14
| PubChem = 25382
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 23697
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q7T0Y1109Z
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08171
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 110094
| C=21 | H=25 | N=1
| SMILES = c3ccc2c(/C(c1c(cccc1)C2(C)C)=C/CCN(C)C)c3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H25N/c1-21(2)19-13-7-5-10-17(19)16(12-9-15-22(3)4)18-11-6-8-14-20(18)21/h5-8,10-14H,9,15H2,1-4H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GWWLWDURRGNSRS-UHFFFAOYSA-N
}}
Melitracen (brand names Melixeran, Trausabun) is a tricyclic antidepressant (TCA), for the treatment of depression and anxiety.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&q=melitracen&pg=PA643}}{{cite book | title = Dictionary of organic compounds | publisher = Chapman & Hall | location = London | year = 1996 | isbn = 0-412-54090-8 | url = https://books.google.com/books?id=x2Su3GKCvtsC&q=melitracen&pg=PA4129 | vauthors = Rhodes PH }}{{cite book | vauthors = O'Neil MJ | title = The Merck index: an encyclopedia of chemicals, drugs, and biologicals | publisher = Merck Research Laboratories | location = Rahway, NJ | year = 2001 | isbn = 0-911910-13-1 | url = https://archive.org/details/merckindexency00onei }}{{cite book | vauthors = Holenz J, Díaz JL, Buschmann H | chapter = Marketed Drugs and Drugs in DevelopmentVela | veditors = JM, Buschmann H, Holenz J, Párraga A, Torrens A | title = Antidepressants, Antipsychotics, Anxiolytics: From Chemistry and Pharmacology to Clinical Application | publisher = Wiley-VCH | location = Weinheim | year = 2007 | isbn = 978-3-527-31058-6 | chapter-url = https://books.google.com/books?id=yXD4QA-Y_Z0C&q=melitracen&pg=PA248}} In addition to single drug preparations, it is also available as Deanxit, marketed by Lundbeck, a combination product containing both melitracen and flupentixol.{{cite book | title = European Drug Index | edition = 4th | publisher = CRC Press | location = Boca Raton | year = 1998 | isbn = 3-7692-2114-1 | url = https://books.google.com/books?id=HiSdvzs2pPAC&q=melitracen&pg=PA327 | vauthors = Muller NF, Dessing RP }}{{cite journal | vauthors = Van Moffaert M, Dierick M, De Meulemeester F, Vereecken A | title = Treatment of depressive anxiety states associated with psychosomatic symptoms. A double-blind multicentre clinical study: mianserin versus melitracen-flupentixol | journal = Acta Psychiatrica Belgica | volume = 83 | issue = 5 | pages = 525–539 | year = 1983 | pmid = 6670581 }}{{cite journal | vauthors = Bin Yaacob H | title = Flupenthixol and Melitracen in the management of trigeminal neuralgia | journal = Dental Journal of Malaysia | volume = 8 | issue = 2 | pages = 37–38 | date = April 1985 | pmid = 3917005 }}{{cite journal | vauthors = Hashash JG, Abdul-Baki H, Azar C, Elhajj II, El Zahabi L, Chaar HF, Sharara AI | title = Clinical trial: a randomized controlled cross-over study of flupenthixol + melitracen in functional dyspepsia | journal = Alimentary Pharmacology & Therapeutics | volume = 27 | issue = 11 | pages = 1148–1155 | date = June 2008 | pmid = 18331614 | doi = 10.1111/j.1365-2036.2008.03677.x | name-list-style = vanc | s2cid = 40714136 | doi-access = free }}
The pharmacology of melitracen has not been properly investigated and is largely unknown, but it is likely to act in a similar manner to other TCAs. Indeed, melitracen is reported to have imipramine and amitriptyline-like effects and efficacy against depression and anxiety, though with improved tolerability and a somewhat faster onset of action.{{cite book | vauthors = Aronson JK | title = Meyler's Side Effects of Psychiatric Drugs (Meylers Side Effects) | publisher = Elsevier Science | location = Amsterdam | year = 2008 | isbn = 978-0-444-53266-4 | url = https://books.google.com/books?id=s0XYvuPVgaAC&q=melitracen%20amitriptyline&pg=PA34}}{{cite book | vauthors = Krapcho J | chapter = Antidepressives and Stimulants | title = Annual Reports in Medicinal Chemistry | volume = 5 | publisher = Academic Press | location = Boston | year = 1970 | isbn = 0-12-040505-9 | chapter-url = https://books.google.com/books?id=JIdV5T356CQC&q=melitracen&pg=PA13}}
See also
References
{{Reflist|30em}}
{{Antidepressants}}
{{Anxiolytics}}
{{Navboxes
| title = Pharmacodynamics
| titlestyle = background:#ccccff
| list1 =
{{Adrenergic receptor modulators}}
{{Histamine receptor modulators}}
{{Monoamine reuptake inhibitors}}
{{Muscarinic acetylcholine receptor modulators}}
{{Serotonin receptor modulators}}
}}
{{Tricyclics}}
Category:Dimethylamino compounds
Category:Tricyclic antidepressants
{{anxiolytic-stub}}