3F-NEB
{{Short description|Substituted cathinone stimulant drug}}
{{cs1 config|name-list-style=vanc}}
{{Drugbox
| IUPAC_name = 2-(ethylamino)-1-(3-fluorophenyl)butan-1-one
| image = 3F-NEB_structure.png
| width = 200px
| tradename =
| routes_of_administration =
| legal_UK = Class B
| legal_DE = Anlage II
| CAS_number =
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII =
| PubChem = 164946359
| ChemSpiderID =
| C=12 | H=16 | F=1 | N=1 | O=1
| StdInChI=1S/C12H16FNO/c1-3-11(14-4-2)12(15)9-6-5-7-10(13)8-9/h5-8,11,14H,3-4H2,1-2H3
| StdInChIKey = FLFAFGGBRUXYBD-UHFFFAOYSA-N
| SMILES = CCC(C(=O)C1=CC(=CC=C1)F)NCC
}}
3-Fluoro-N-ethylbuphedrone (3F-NEB) is a substituted cathinone derivative with stimulant effects which has been sold as a designer drug. It was first identified in Sweden in 2021.{{cite book | url = https://www.emcdda.europa.eu/system/files/publications/14637/20222218_PDF_TD0522113ENN_002.pdf | title = New psychoactive substances: 25 years of early warning and response in Europe. An update from the EU Early Warning System | publisher = European Monitoring Centre for Drugs and Drug Addiction | date = June 2022 | isbn = 978-92-9497-737-3 | doi = 10.2810/882318 | author1 = European Monitoring Centre for Drugs and Drug Addiction. | doi-broken-date = 2024-11-02 }}{{cite journal | vauthors = Kuropka P, Zawadzki M, Szpot P | title = A review of synthetic cathinones emerging in recent years (2019-2022) | journal = Forensic Toxicology | volume = 41| issue = 1| pages = 25–46 | date = September 2022 | pmid = 36124107 | pmc = 9476408 | doi = 10.1007/s11419-022-00639-5 }}
See also
References
{{reflist}}
{{Stimulants}}
{{Phenethylamines}}
Category:3-Fluorophenyl compounds