3F-NEH

{{Short description|Substituted cathinone stimulant drug}}

{{Drugbox

| IUPAC_name = 2-(ethylamino)-1-(3-fluorophenyl)hexan-1-one

| image = 3F-NEH.svg

| width = 220

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number =

| PubChem = 163195773

| ChemSpiderID =

| ChEMBL =

| ChEBI =

| UNII = J86LFK6UP6

| C=14 | H=20 | F=1 | N=1 | O=1

| smiles = O=C(c1cc(F)ccc1)C(CCCC)NCC

| StdInChIKey =

}}

3F-NEH (3-Fluoro-N-Ethylhexedrone) is a recreational designer drug from the substituted cathinone family, with stimulant effects. It was first identified in Sweden in October 2020.{{cite book | url = https://www.emcdda.europa.eu/system/files/publications/13464/20205648_TD0320796ENN_PDF_rev.pdf | title = New psychoactive substances: global markets, glocal threats and the COVID-19 pandemic. An update from the EU Early Warning System | author = European Monitoring Center for Drugs and Drug Addiction | location = Luxembourg | publisher = Publications Office of the European Union | date = December 2020 | doi = 10.2810/921262 | isbn = 9789294975584 }}