3F-PiHP

{{Short description|Substituted cathinone stimulant drug}}

{{Drugbox

| IUPAC_name = 1-(3-fluorophenyl)-4-methyl-2-(pyrrolidin-1-yl)pentan-1-one

| image = 3F-α-PiHP.svg

| width = 220

| pregnancy_category =

| legal_CA =Schedule I

| legal_DE = NpSG

| legal_UK = Class B

| legal_US = Unscheduled

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number =

| PubChem = 163192825

| ChemSpiderID =

| ChEMBL =

| ChEBI =

| UNII = XZF8YZF3PN

| C=16 | H=22 | F=1 | N=1 | O=1

| smiles = O=C(C(CC(C)C)N1CCCC1)C2=CC(F)=CC=C2

| StdInChI =

| StdInChIKey =

}}

3F-PiHP (3F-α-PiHP) is a recreational designer drug from the substituted cathinone family, with stimulant effects. It was first identified in both Sweden and Finland in mid-2019,{{cite report | url = https://www.emcdda.europa.eu/system/files/publications/13464/20205648_TD0320796ENN_PDF_rev.pdf | title = New psychoactive substances: global markets, glocal threats and the COVID-19 pandemic. An update from the EU Early Warning System | author = European Monitoring Center for Drugs and Drug Addiction | location = Luxembourg | publisher = Publications Office of the European Union | date = December 2020 | doi = 10.2810/921262 }} and was made illegal in Finland in August 2019.{{cite web | url = https://finlex.fi/fi/lainsaadanto/2014/1130 | title = Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista | trans-title = Government Decree on Psychoactive Substances Banned from the Consumer Market | language = Finnish | work = Finlex Data Bank }}