Aleph-2
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name =
| image = 2,5-dimethoxy-4-ethylthioamphetamine.svg
| width =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration = Oral
| class = Serotonergic psychedelic; Hallucinogen; Serotonin 5-HT2 receptor agonist
| ATC_prefix =
| ATC_suffix =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action = 8–16{{nbsp}}hours
| excretion =
| CAS_number = 185562-00-9
| CAS_supplemental =
| PubChem = 10264356
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank = DB13940
| ChemSpiderID = 8439835
| UNII = Z1I419DRZZ
| KEGG =
| ChEBI =
| ChEMBL = 339611
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = ALEPH-2; 2,5-Dimethoxy-4-ethylthioamphetamine; 4-Ethylthio-2,5-dimethoxyamphetamine; DOT-2
| IUPAC_name = 1-(4-ethylsulfanyl-2,5-dimethoxyphenyl)propan-2-amine
| C=13 | H=21 | N=1 | O=2 | S=1
| SMILES = CCSC1=C(C=C(C(=C1)OC)CC(C)N)OC
| StdInChI = 1S/C13H21NO2S/c1-5-17-13-8-11(15-3)10(6-9(2)14)7-12(13)16-4/h7-9H,5-6,14H2,1-4H3
| StdInChIKey = MCYCODJKXUJSAT-UHFFFAOYSA-N
}}
Aleph-2, or ALEPH-2, also known as 2,5-dimethoxy-4-ethylthioamphetamine, is a serotonergic psychedelic of the phenethylamine, amphetamine, and DOx families.{{cite book | vauthors = Shulgin T, Shulgin A | chapter = #4 ALEPH-2 2,5-DIMETHOXY-4-ETHYLTHIOAMPHETAMINE | pages = 464–467 | chapter-url = https://www.erowid.org/library/books_online/pihkal/pihkal004.shtml | title = PiHKAL: A Chemical Love Story | date = 1991 | publisher = Transform Press | edition = 1st | location = Berkeley, CA | isbn = 978-0-9630096-0-9 | oclc = 25627628 | url = https://books.google.com/books?id=O8AdHBGybpcC }}{{cite book | vauthors = Shulgin A, Manning T, Daley PF | chapter = #4. ALEPH-2 | pages = 5 | chapter-url = https://archive.org/details/shulgin-index-vol-1/page/5/mode/1up | title = The Shulgin Index, Volume One: Psychedelic Phenethylamines and Related Compounds | publisher = Transform Press | location = Berkeley, CA | volume = 1 | year = 2011 | isbn = 978-0-9630096-3-0 | oclc = 709667010 }}
Use and effects
According to Alexander Shulgin, its dosage is 4 to 8{{nbsp}}mg orally and its duration is 8 to 16{{nbsp}}hours. The drug is said to produce strong visuals.
Pharmacology
Aleph-2 acts as a serotonin 5-HT2 receptor agonist.{{cite journal | vauthors = Ray TS | title = Psychedelics and the human receptorome | journal = PLOS ONE | volume = 5 | issue = 2 | pages = e9019 | date = February 2010 | pmid = 20126400 | pmc = 2814854 | doi = 10.1371/journal.pone.0009019 | doi-access = free | bibcode = 2010PLoSO...5.9019R }} The drug is also a weak monoamine oxidase inhibitor (MAOI), with {{Abbrlink|IC50|half-maximal inhibitory concentration}} values of 3,200{{nbsp}}nM for monoamine oxidase A (MAO-A) and >100,000{{nbsp}}nM for monoamine oxidase B (MAO-B). Aleph-2 produces anxiolytic effects in rodents.{{cite journal | vauthors = Acuña-Castillo C, Scorza C, Reyes-Parada M, Cassels BK, Huidobro-Toro JP | title = ALEPH-2, a suspected anxiolytic and putative hallucinogenic phenylisopropylamine derivative, is a 5-HT2a and 5-HT2c receptor agonist | journal = Life Sciences | volume = 67 | issue = 26 | pages = 3241–3247 | date = November 2000 | pmid = 11191631 | doi = 10.1016/s0024-3205(00)00906-1 }}{{cite journal | vauthors = Scorza MC, Reyes-Parada M, Silveira R, Viola H, Medina JH, Viana MB, Zangrossi H, Graeff FG | title = Behavioral effects of the putative anxiolytic (+/-)-1-(2,5-dimethoxy-4-ethylthiophenyl)-2-aminopropane (ALEPH-2) in rats and mice | journal = Pharmacology, Biochemistry, and Behavior | volume = 54 | issue = 2 | pages = 355–361 | date = June 1996 | pmid = 8743595 | doi = 10.1016/0091-3057(95)02149-3 }}{{cite journal | vauthors = Reyes-Parada M, Scorza C, Romero V, Silveira R, Medina JH, Andrus D, Nichols DE, Cassels BK | title = (+/-)-1-(2,5-Dimethoxy-4-ethylthiophenyl)-2-aminopropane (ALEPH-2), a novel putative anxiolytic agent lacking affinity for benzodiazepine sites and serotonin-1A receptors | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 354 | issue = 5 | pages = 579–585 | date = November 1996 | pmid = 8938655 | doi = 10.1007/BF00170831 }}
See also
References
{{Reflist}}
External links
- [https://isomerdesign.com/pihkal/explore/4 ALEPH-2 - Isomer Design]
- [https://www.erowid.org/library/books_online/pihkal/pihkal004.shtml ALEPH-2 - PiHKAL - Erowid]
- [https://isomerdesign.com/pihkal/read/pk/4 ALEPH-2 - PiHKAL - Isomer Design]
{{Psychedelics}}
{{Serotonin receptor modulators}}
{{Monoamine metabolism modulators}}
{{Phenethylamines}}
Category:Monoamine oxidase inhibitors